C16H16N4OS — CID 118736916
N-(oxan-4-yl)-6-(1,3-thiazol-5-yl)quinazolin-4-amine (PubChem CID 118736916) has the molecular formula C16H16N4OS and a molecular weight of 312.40 g/mol. Its IUPAC name is N-(oxan-4-yl)-6-(1,3-thiazol-5-yl)quinazolin-4-amine.
| Compound Name | N-(oxan-4-yl)-6-(1,3-thiazol-5-yl)quinazolin-4-amine |
|---|---|
| PubChem CID | 118736916 |
| Molecular Formula | C16H16N4OS |
| Molecular Weight | 312.40 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | N-(oxan-4-yl)-6-(1,3-thiazol-5-yl)quinazolin-4-amine |
| SMILES | c1nc(NC2CCOCC2)c2cc(-c3cncs3)ccc2n1 |
| InChI | InChI=1S/C16H16N4OS/c1-2-14-13(7-11(1)15-8-17-10-22-15)16(19-9-18-14)20-12-3-5-21-6-4-12/h1-2,7-10,12H,3-6H2,(H,18,19,20) |
| InChIKey | ODGOHANETZJRIS-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.40 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |