C25H32N6O — CID 69186801
N-cyclohexyl-6-[6-(2-morpholin-4-ylethylamino)-3-pyridinyl]quinazolin-4-amine (PubChem CID 69186801) has the molecular formula C25H32N6O and a molecular weight of 432.57 g/mol. Its IUPAC name is N-cyclohexyl-6-[6-(2-morpholin-4-ylethylamino)-3-pyridinyl]quinazolin-4-amine.
| Compound Name | N-cyclohexyl-6-[6-(2-morpholin-4-ylethylamino)-3-pyridinyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 69186801 |
| Molecular Formula | C25H32N6O |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.26 |
| IUPAC Name | N-cyclohexyl-6-[6-(2-morpholin-4-ylethylamino)-3-pyridinyl]quinazolin-4-amine |
| SMILES | c1nc(NC2CCCCC2)c2cc(-c3ccc(NCCN4CCOCC4)nc3)ccc2n1 |
| InChI | InChI=1S/C25H32N6O/c1-2-4-21(5-3-1)30-25-22-16-19(6-8-23(22)28-18-29-25)20-7-9-24(27-17-20)26-10-11-31-12-14-32-15-13-31/h6-9,16-18,21H,1-5,10-15H2,(H,26,27)(H,28,29,30) |
| InChIKey | TVTWMLZEFUOXPO-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 75.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |