C22H24N4 — CID 68946542
N-cyclopropyl-6-[3-[1-(cyclopropylamino)ethyl]phenyl]quinazolin-4-amine (PubChem CID 68946542) has the molecular formula C22H24N4 and a molecular weight of 344.46 g/mol. Its IUPAC name is N-cyclopropyl-6-[3-[1-(cyclopropylamino)ethyl]phenyl]quinazolin-4-amine.
| Compound Name | N-cyclopropyl-6-[3-[1-(cyclopropylamino)ethyl]phenyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 68946542 |
| Molecular Formula | C22H24N4 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | N-cyclopropyl-6-[3-[1-(cyclopropylamino)ethyl]phenyl]quinazolin-4-amine |
| SMILES | CC(NC1CC1)c1cccc(-c2ccc3ncnc(NC4CC4)c3c2)c1 |
| InChI | InChI=1S/C22H24N4/c1-14(25-18-6-7-18)15-3-2-4-16(11-15)17-5-10-21-20(12-17)22(24-13-23-21)26-19-8-9-19/h2-5,10-14,18-19,25H,6-9H2,1H3,(H,23,24,26) |
| InChIKey | QJTSJIUCYCAGMX-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |