About N-cyclopropyl-6-[3-[(cyclopropylamino)methyl]phenyl]quinazolin-4-amine;pentanoic acid
N-cyclopropyl-6-[3-[(cyclopropylamino)methyl]phenyl]quinazolin-4-amine;pentanoic acid (PubChem CID 172789188) has the molecular formula C26H32N4O2
and a molecular weight of 432.57 g/mol. Its IUPAC name is N-cyclopropyl-6-[3-[(cyclopropylamino)methyl]phenyl]quinazolin-4-amine;pentanoic acid.
Molecular Properties
| Compound Name | N-cyclopropyl-6-[3-[(cyclopropylamino)methyl]phenyl]quinazolin-4-amine;pentanoic acid |
| PubChem CID | 172789188 |
| Molecular Formula | C26H32N4O2 |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.25 |
| IUPAC Name | N-cyclopropyl-6-[3-[(cyclopropylamino)methyl]phenyl]quinazolin-4-amine;pentanoic acid |
| SMILES | CCCCC(=O)O.c1cc(CNC2CC2)cc(-c2ccc3ncnc(NC4CC4)c3c2)c1 |
| InChI | InChI=1S/C21H22N4.C5H10O2/c1-2-14(12-22-17-5-6-17)10-15(3-1)16-4-9-20-19(11-16)21(24-13-23-20)25-18-7-8-18;1-2-3-4-5(6)7/h1-4,9-11,13,17-18,22H,5-8,12H2,(H,23,24,25);2-4H2,1H3,(H,6,7) |
| InChIKey | PIBLUPNARKJCHO-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-cyclopropyl-6-[3-[(cyclopropylamino)methyl]phenyl]quinazolin-4-amine;pentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopropyl-6-[3-[(cyclopropylamino)methyl]phenyl]quinazolin-4-amine;pentanoic acid?
The IUPAC name of N-cyclopropyl-6-[3-[(cyclopropylamino)methyl]phenyl]quinazolin-4-amine;pentanoic acid (CID 172789188) is N-cyclopropyl-6-[3-[(cyclopropylamino)methyl]phenyl]quinazolin-4-amine;pentanoic acid.
What is the SMILES notation for N-cyclopropyl-6-[3-[(cyclopropylamino)methyl]phenyl]quinazolin-4-amine;pentanoic acid?
The canonical SMILES for N-cyclopropyl-6-[3-[(cyclopropylamino)methyl]phenyl]quinazolin-4-amine;pentanoic acid is CCCCC(=O)O.c1cc(CNC2CC2)cc(-c2ccc3ncnc(NC4CC4)c3c2)c1.
What is the InChIKey of N-cyclopropyl-6-[3-[(cyclopropylamino)methyl]phenyl]quinazolin-4-amine;pentanoic acid?
The InChIKey is PIBLUPNARKJCHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22N4.C5H10O2/c1-2-14(12-22-17-5-6-17)10-15(3-1)16-4-9-20-19(11-16)21(24-13-23-20)25-18-7-8-18;1-2-3-4-5(6)7/h1-4,9-11,13,17-18,22H,5-8,12H2,(H,23,24,25);2-4H2,1H3,(H,6,7).
What are the key properties of N-cyclopropyl-6-[3-[(cyclopropylamino)methyl]phenyl]quinazolin-4-amine;pentanoic acid?
N-cyclopropyl-6-[3-[(cyclopropylamino)methyl]phenyl]quinazolin-4-amine;pentanoic acid has a molecular weight of 432.57 g/mol, XLogP of 5.38, 9 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopropyl-6-[3-[(cyclopropylamino)methyl]phenyl]quinazolin-4-amine;pentanoic acid is sourced from PubChem (CID 172789188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).