C21H20N4O5 — CID 68946679
4-[[3-[4-[carboxy(methyl)amino]quinazolin-6-yl]phenyl]methylamino]-4-oxobutanoic acid (PubChem CID 68946679) has the molecular formula C21H20N4O5 and a molecular weight of 408.41 g/mol. Its IUPAC name is 4-[[3-[4-[carboxy(methyl)amino]quinazolin-6-yl]phenyl]methylamino]-4-oxobutanoic acid.
| Compound Name | 4-[[3-[4-[carboxy(methyl)amino]quinazolin-6-yl]phenyl]methylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 68946679 |
| Molecular Formula | C21H20N4O5 |
| Molecular Weight | 408.41 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | 4-[[3-[4-[carboxy(methyl)amino]quinazolin-6-yl]phenyl]methylamino]-4-oxobutanoic acid |
| SMILES | CN(C(=O)O)c1ncnc2ccc(-c3cccc(CNC(=O)CCC(=O)O)c3)cc12 |
| InChI | InChI=1S/C21H20N4O5/c1-25(21(29)30)20-16-10-15(5-6-17(16)23-12-24-20)14-4-2-3-13(9-14)11-22-18(26)7-8-19(27)28/h2-6,9-10,12H,7-8,11H2,1H3,(H,22,26)(H,27,28)(H,29,30) |
| InChIKey | RRAOAFBNEDKCPJ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 132.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.41 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |