C27H27ClN4O — CID 57434970
4-chloro-N-[[3-[4-(diethylamino)quinazolin-6-yl]phenyl]methyl]-N-methylbenzamide (PubChem CID 57434970) has the molecular formula C27H27ClN4O and a molecular weight of 458.99 g/mol. Its IUPAC name is 4-chloro-N-[[3-[4-(diethylamino)quinazolin-6-yl]phenyl]methyl]-N-methylbenzamide.
| Compound Name | 4-chloro-N-[[3-[4-(diethylamino)quinazolin-6-yl]phenyl]methyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 57434970 |
| Molecular Formula | C27H27ClN4O |
| Molecular Weight | 458.99 g/mol |
| Exact Mass | 458.19 |
| IUPAC Name | 4-chloro-N-[[3-[4-(diethylamino)quinazolin-6-yl]phenyl]methyl]-N-methylbenzamide |
| SMILES | CCN(CC)c1ncnc2ccc(-c3cccc(CN(C)C(=O)c4ccc(Cl)cc4)c3)cc12 |
| InChI | InChI=1S/C27H27ClN4O/c1-4-32(5-2)26-24-16-22(11-14-25(24)29-18-30-26)21-8-6-7-19(15-21)17-31(3)27(33)20-9-12-23(28)13-10-20/h6-16,18H,4-5,17H2,1-3H3 |
| InChIKey | UZTHIGUOVLDOLA-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.99 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |