C25H24N4O2 — CID 68945376
N-[[3-[4-(cyclopropylamino)quinazolin-6-yl]phenyl]methyl]-N-(furan-2-ylmethyl)acetamide (PubChem CID 68945376) has the molecular formula C25H24N4O2 and a molecular weight of 412.49 g/mol. Its IUPAC name is N-[[3-[4-(cyclopropylamino)quinazolin-6-yl]phenyl]methyl]-N-(furan-2-ylmethyl)acetamide.
| Compound Name | N-[[3-[4-(cyclopropylamino)quinazolin-6-yl]phenyl]methyl]-N-(furan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 68945376 |
| Molecular Formula | C25H24N4O2 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | N-[[3-[4-(cyclopropylamino)quinazolin-6-yl]phenyl]methyl]-N-(furan-2-ylmethyl)acetamide |
| SMILES | CC(=O)N(Cc1cccc(-c2ccc3ncnc(NC4CC4)c3c2)c1)Cc1ccco1 |
| InChI | InChI=1S/C25H24N4O2/c1-17(30)29(15-22-6-3-11-31-22)14-18-4-2-5-19(12-18)20-7-10-24-23(13-20)25(27-16-26-24)28-21-8-9-21/h2-7,10-13,16,21H,8-9,14-15H2,1H3,(H,26,27,28) |
| InChIKey | NSEAFXCBZBUXSS-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |