C24H23N5O — CID 57435011
2-cyano-N-cyclopropyl-N-[[3-[4-(cyclopropylamino)quinazolin-6-yl]phenyl]methyl]acetamide (PubChem CID 57435011) has the molecular formula C24H23N5O and a molecular weight of 397.48 g/mol. Its IUPAC name is 2-cyano-N-cyclopropyl-N-[[3-[4-(cyclopropylamino)quinazolin-6-yl]phenyl]methyl]acetamide.
| Compound Name | 2-cyano-N-cyclopropyl-N-[[3-[4-(cyclopropylamino)quinazolin-6-yl]phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 57435011 |
| Molecular Formula | C24H23N5O |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | 2-cyano-N-cyclopropyl-N-[[3-[4-(cyclopropylamino)quinazolin-6-yl]phenyl]methyl]acetamide |
| SMILES | N#CCC(=O)N(Cc1cccc(-c2ccc3ncnc(NC4CC4)c3c2)c1)C1CC1 |
| InChI | InChI=1S/C24H23N5O/c25-11-10-23(30)29(20-7-8-20)14-16-2-1-3-17(12-16)18-4-9-22-21(13-18)24(27-15-26-22)28-19-5-6-19/h1-4,9,12-13,15,19-20H,5-8,10,14H2,(H,26,27,28) |
| InChIKey | UHKAULSWTXITTL-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 81.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |