C19H13N5O2S — CID 118737092
4-[3-(2-aminopyrimidin-4-yl)indol-1-yl]sulfonylbenzonitrile (PubChem CID 118737092) has the molecular formula C19H13N5O2S and a molecular weight of 375.41 g/mol. Its IUPAC name is 4-[3-(2-aminopyrimidin-4-yl)indol-1-yl]sulfonylbenzonitrile.
| Compound Name | 4-[3-(2-aminopyrimidin-4-yl)indol-1-yl]sulfonylbenzonitrile |
|---|---|
| PubChem CID | 118737092 |
| Molecular Formula | C19H13N5O2S |
| Molecular Weight | 375.41 g/mol |
| Exact Mass | 375.08 |
| IUPAC Name | 4-[3-(2-aminopyrimidin-4-yl)indol-1-yl]sulfonylbenzonitrile |
| SMILES | N#Cc1ccc(S(=O)(=O)n2cc(-c3ccnc(N)n3)c3ccccc32)cc1 |
| InChI | InChI=1S/C19H13N5O2S/c20-11-13-5-7-14(8-6-13)27(25,26)24-12-16(15-3-1-2-4-18(15)24)17-9-10-22-19(21)23-17/h1-10,12H,(H2,21,22,23) |
| InChIKey | KIFMGSMLZGCTRJ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 114.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.41 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |