C18H12F2N4O2S — CID 118737104
4-[1-(2,4-difluorophenyl)sulfonylindol-3-yl]pyrimidin-2-amine (PubChem CID 118737104) has the molecular formula C18H12F2N4O2S and a molecular weight of 386.38 g/mol. Its IUPAC name is 4-[1-(2,4-difluorophenyl)sulfonylindol-3-yl]pyrimidin-2-amine.
| Compound Name | 4-[1-(2,4-difluorophenyl)sulfonylindol-3-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 118737104 |
| Molecular Formula | C18H12F2N4O2S |
| Molecular Weight | 386.38 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | 4-[1-(2,4-difluorophenyl)sulfonylindol-3-yl]pyrimidin-2-amine |
| SMILES | Nc1nccc(-c2cn(S(=O)(=O)c3ccc(F)cc3F)c3ccccc23)n1 |
| InChI | InChI=1S/C18H12F2N4O2S/c19-11-5-6-17(14(20)9-11)27(25,26)24-10-13(12-3-1-2-4-16(12)24)15-7-8-22-18(21)23-15/h1-10H,(H2,21,22,23) |
| InChIKey | FEFDYGPAGGZJPT-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.38 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |