C24H25NO3S — CID 118737151
3-[3-(5,6,7,8-tetrahydronaphthalen-2-yloxy)propyl]-9-thia-1-azatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraene-2-carboxylic acid (PubChem CID 118737151) has the molecular formula C24H25NO3S and a molecular weight of 407.54 g/mol. Its IUPAC name is 3-[3-(5,6,7,8-tetrahydronaphthalen-2-yloxy)propyl]-9-thia-1-azatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraene-2-carboxylic acid.
| Compound Name | 3-[3-(5,6,7,8-tetrahydronaphthalen-2-yloxy)propyl]-9-thia-1-azatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraene-2-carboxylic acid |
|---|---|
| PubChem CID | 118737151 |
| Molecular Formula | C24H25NO3S |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | 3-[3-(5,6,7,8-tetrahydronaphthalen-2-yloxy)propyl]-9-thia-1-azatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraene-2-carboxylic acid |
| SMILES | O=C(O)c1c(CCCOc2ccc3c(c2)CCCC3)c2cccc3c2n1CCS3 |
| InChI | InChI=1S/C24H25NO3S/c26-24(27)23-20(19-7-3-9-21-22(19)25(23)12-14-29-21)8-4-13-28-18-11-10-16-5-1-2-6-17(16)15-18/h3,7,9-11,15H,1-2,4-6,8,12-14H2,(H,26,27) |
| InChIKey | HASLVVNHEHIJPI-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|