C15H10INO4S — CID 118737272
N-(2,2-dioxo-1,2λ6-benzoxathiin-6-yl)-2-iodobenzamide (PubChem CID 118737272) has the molecular formula C15H10INO4S and a molecular weight of 427.22 g/mol. Its IUPAC name is N-(2,2-dioxo-1,2λ6-benzoxathiin-6-yl)-2-iodobenzamide.
| Compound Name | N-(2,2-dioxo-1,2λ6-benzoxathiin-6-yl)-2-iodobenzamide |
|---|---|
| PubChem CID | 118737272 |
| Molecular Formula | C15H10INO4S |
| Molecular Weight | 427.22 g/mol |
| Exact Mass | 426.94 |
| IUPAC Name | N-(2,2-dioxo-1,2λ6-benzoxathiin-6-yl)-2-iodobenzamide |
| SMILES | O=C(Nc1ccc2c(c1)C=CS(=O)(=O)O2)c1ccccc1I |
| InChI | InChI=1S/C15H10INO4S/c16-13-4-2-1-3-12(13)15(18)17-11-5-6-14-10(9-11)7-8-22(19,20)21-14/h1-9H,(H,17,18) |
| InChIKey | OLQGNUICXQMICD-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.22 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|