C15H17N3O — CID 118738010
3-(4-methylphenyl)-4,5,6,7-tetrahydro-1H-indazole-7-carboxamide (PubChem CID 118738010) has the molecular formula C15H17N3O and a molecular weight of 255.32 g/mol. Its IUPAC name is 3-(4-methylphenyl)-4,5,6,7-tetrahydro-1H-indazole-7-carboxamide.
| Compound Name | 3-(4-methylphenyl)-4,5,6,7-tetrahydro-1H-indazole-7-carboxamide |
|---|---|
| PubChem CID | 118738010 |
| Molecular Formula | C15H17N3O |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | 3-(4-methylphenyl)-4,5,6,7-tetrahydro-1H-indazole-7-carboxamide |
| SMILES | Cc1ccc(-c2n[nH]c3c2CCCC3C(N)=O)cc1 |
| InChI | InChI=1S/C15H17N3O/c1-9-5-7-10(8-6-9)13-11-3-2-4-12(15(16)19)14(11)18-17-13/h5-8,12H,2-4H2,1H3,(H2,16,19)(H,17,18) |
| InChIKey | HEDUJHAQQTVIOB-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |