C14H13Cl2N3O — CID 118738004
3-(3,4-dichlorophenyl)-4,5,6,7-tetrahydro-1H-indazole-7-carboxamide (PubChem CID 118738004) has the molecular formula C14H13Cl2N3O and a molecular weight of 310.18 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-4,5,6,7-tetrahydro-1H-indazole-7-carboxamide.
| Compound Name | 3-(3,4-dichlorophenyl)-4,5,6,7-tetrahydro-1H-indazole-7-carboxamide |
|---|---|
| PubChem CID | 118738004 |
| Molecular Formula | C14H13Cl2N3O |
| Molecular Weight | 310.18 g/mol |
| Exact Mass | 309.04 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-4,5,6,7-tetrahydro-1H-indazole-7-carboxamide |
| SMILES | NC(=O)C1CCCc2c(-c3ccc(Cl)c(Cl)c3)n[nH]c21 |
| InChI | InChI=1S/C14H13Cl2N3O/c15-10-5-4-7(6-11(10)16)12-8-2-1-3-9(14(17)20)13(8)19-18-12/h4-6,9H,1-3H2,(H2,17,20)(H,18,19) |
| InChIKey | OQZPEYDZBJDMCK-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.18 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |