C26H27ClN2O9S2 — CID 118738147
2-[4-[[3-[(5-chloro-2-methoxyphenyl)sulfonyl-(2-sulfinoethyl)amino]-4-ethoxybenzoyl]amino]phenyl]acetic acid (PubChem CID 118738147) has the molecular formula C26H27ClN2O9S2 and a molecular weight of 611.09 g/mol. Its IUPAC name is 2-[4-[[3-[(5-chloro-2-methoxyphenyl)sulfonyl-(2-sulfinoethyl)amino]-4-ethoxybenzoyl]amino]phenyl]acetic acid.
| Compound Name | 2-[4-[[3-[(5-chloro-2-methoxyphenyl)sulfonyl-(2-sulfinoethyl)amino]-4-ethoxybenzoyl]amino]phenyl]acetic acid |
|---|---|
| PubChem CID | 118738147 |
| Molecular Formula | C26H27ClN2O9S2 |
| Molecular Weight | 611.09 g/mol |
| Exact Mass | 610.08 |
| IUPAC Name | 2-[4-[[3-[(5-chloro-2-methoxyphenyl)sulfonyl-(2-sulfinoethyl)amino]-4-ethoxybenzoyl]amino]phenyl]acetic acid |
| SMILES | CCOc1ccc(C(=O)Nc2ccc(CC(=O)O)cc2)cc1N(CCS(=O)O)S(=O)(=O)c1cc(Cl)ccc1OC |
| InChI | InChI=1S/C26H27ClN2O9S2/c1-3-38-22-10-6-18(26(32)28-20-8-4-17(5-9-20)14-25(30)31)15-21(22)29(12-13-39(33)34)40(35,36)24-16-19(27)7-11-23(24)37-2/h4-11,15-16H,3,12-14H2,1-2H3,(H,28,32)(H,30,31)(H,33,34) |
| InChIKey | FHOZQMWMWFLNDW-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 159.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.09 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|