C24H27N3O6S — CID 30838314
N-[3-(dimethylsulfamoyl)-4-methoxyphenyl]-3-ethoxy-4-(pyridin-4-ylmethoxy)benzamide (PubChem CID 30838314) has the molecular formula C24H27N3O6S and a molecular weight of 485.56 g/mol. Its IUPAC name is N-[3-(dimethylsulfamoyl)-4-methoxyphenyl]-3-ethoxy-4-(pyridin-4-ylmethoxy)benzamide.
| Compound Name | N-[3-(dimethylsulfamoyl)-4-methoxyphenyl]-3-ethoxy-4-(pyridin-4-ylmethoxy)benzamide |
|---|---|
| PubChem CID | 30838314 |
| Molecular Formula | C24H27N3O6S |
| Molecular Weight | 485.56 g/mol |
| Exact Mass | 485.16 |
| IUPAC Name | N-[3-(dimethylsulfamoyl)-4-methoxyphenyl]-3-ethoxy-4-(pyridin-4-ylmethoxy)benzamide |
| SMILES | CCOc1cc(C(=O)Nc2ccc(OC)c(S(=O)(=O)N(C)C)c2)ccc1OCc1ccncc1 |
| InChI | InChI=1S/C24H27N3O6S/c1-5-32-22-14-18(6-8-20(22)33-16-17-10-12-25-13-11-17)24(28)26-19-7-9-21(31-4)23(15-19)34(29,30)27(2)3/h6-15H,5,16H2,1-4H3,(H,26,28) |
| InChIKey | URLHUXWKWJOIDM-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 107.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.56 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |