C11H14N4 — CID 118739847
5-(1-methylpyrrolidin-2-yl)imidazo[1,2-a]pyrimidine (PubChem CID 118739847) has the molecular formula C11H14N4 and a molecular weight of 202.26 g/mol. Its IUPAC name is 5-(1-methylpyrrolidin-2-yl)imidazo[1,2-a]pyrimidine.
| Compound Name | 5-(1-methylpyrrolidin-2-yl)imidazo[1,2-a]pyrimidine |
|---|---|
| PubChem CID | 118739847 |
| Molecular Formula | C11H14N4 |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | 5-(1-methylpyrrolidin-2-yl)imidazo[1,2-a]pyrimidine |
| SMILES | CN1CCCC1c1ccnc2nccn12 |
| InChI | InChI=1S/C11H14N4/c1-14-7-2-3-9(14)10-4-5-12-11-13-6-8-15(10)11/h4-6,8-9H,2-3,7H2,1H3 |
| InChIKey | WVHZAVDZASMQMQ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 33.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |