C12H16N4O4S — CID 118741297
(2S)-N-[[3-(furan-2-yl)-1H-pyrazol-5-yl]methyl]-2-(methanesulfonamido)propanamide (PubChem CID 118741297) has the molecular formula C12H16N4O4S and a molecular weight of 312.35 g/mol. Its IUPAC name is (2S)-N-[[3-(furan-2-yl)-1H-pyrazol-5-yl]methyl]-2-(methanesulfonamido)propanamide.
| Compound Name | (2S)-N-[[3-(furan-2-yl)-1H-pyrazol-5-yl]methyl]-2-(methanesulfonamido)propanamide |
|---|---|
| PubChem CID | 118741297 |
| Molecular Formula | C12H16N4O4S |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | (2S)-N-[[3-(furan-2-yl)-1H-pyrazol-5-yl]methyl]-2-(methanesulfonamido)propanamide |
| SMILES | C[C@H](NS(C)(=O)=O)C(=O)NCc1cc(-c2ccco2)n[nH]1 |
| InChI | InChI=1S/C12H16N4O4S/c1-8(16-21(2,18)19)12(17)13-7-9-6-10(15-14-9)11-4-3-5-20-11/h3-6,8,16H,7H2,1-2H3,(H,13,17)(H,14,15)/t8-/m0/s1 |
| InChIKey | VQSHFZLGJBJEAG-QMMMGPOBSA-N |
| XLogP | 0.22 |
| TPSA | 117.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |