C19H26N6O — CID 118741386
1-[4-(5-cyclohexyl-1H-pyrazol-4-yl)pyrimidin-2-yl]piperidine-4-carboxamide (PubChem CID 118741386) has the molecular formula C19H26N6O and a molecular weight of 354.46 g/mol. Its IUPAC name is 1-[4-(5-cyclohexyl-1H-pyrazol-4-yl)pyrimidin-2-yl]piperidine-4-carboxamide.
| Compound Name | 1-[4-(5-cyclohexyl-1H-pyrazol-4-yl)pyrimidin-2-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 118741386 |
| Molecular Formula | C19H26N6O |
| Molecular Weight | 354.46 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | 1-[4-(5-cyclohexyl-1H-pyrazol-4-yl)pyrimidin-2-yl]piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(c2nccc(-c3cn[nH]c3C3CCCCC3)n2)CC1 |
| InChI | InChI=1S/C19H26N6O/c20-18(26)14-7-10-25(11-8-14)19-21-9-6-16(23-19)15-12-22-24-17(15)13-4-2-1-3-5-13/h6,9,12-14H,1-5,7-8,10-11H2,(H2,20,26)(H,22,24) |
| InChIKey | PZCKMBKCOVRTLM-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 100.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.46 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |