C10H13N5OS — CID 114081983
1-(4-carbamothioylpyrimidin-2-yl)pyrrolidine-3-carboxamide (PubChem CID 114081983) has the molecular formula C10H13N5OS and a molecular weight of 251.31 g/mol. Its IUPAC name is 1-(4-carbamothioylpyrimidin-2-yl)pyrrolidine-3-carboxamide.
| Compound Name | 1-(4-carbamothioylpyrimidin-2-yl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 114081983 |
| Molecular Formula | C10H13N5OS |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | 1-(4-carbamothioylpyrimidin-2-yl)pyrrolidine-3-carboxamide |
| SMILES | NC(=O)C1CCN(c2nccc(C(N)=S)n2)C1 |
| InChI | InChI=1S/C10H13N5OS/c11-8(16)6-2-4-15(5-6)10-13-3-1-7(14-10)9(12)17/h1,3,6H,2,4-5H2,(H2,11,16)(H2,12,17) |
| InChIKey | XRLSYMPMZJVXGE-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 98.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|