C11H16N4OS — CID 107548161
2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]pyrimidine-4-carbothioamide (PubChem CID 107548161) has the molecular formula C11H16N4OS and a molecular weight of 252.34 g/mol. Its IUPAC name is 2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]pyrimidine-4-carbothioamide.
| Compound Name | 2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]pyrimidine-4-carbothioamide |
|---|---|
| PubChem CID | 107548161 |
| Molecular Formula | C11H16N4OS |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | 2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]pyrimidine-4-carbothioamide |
| SMILES | C[C@@H]1CN(c2nccc(C(N)=S)n2)C[C@H](C)O1 |
| InChI | InChI=1S/C11H16N4OS/c1-7-5-15(6-8(2)16-7)11-13-4-3-9(14-11)10(12)17/h3-4,7-8H,5-6H2,1-2H3,(H2,12,17)/t7-,8+ |
| InChIKey | ODZFRQOHKPRGEE-OCAPTIKFSA-N |
| XLogP | 0.72 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|