About 3-pyridin-4-yl-1,8-diazaspiro[4.5]decan-2-one;dihydrochloride
3-pyridin-4-yl-1,8-diazaspiro[4.5]decan-2-one;dihydrochloride (PubChem CID 118742153) has the molecular formula C13H19Cl2N3O
and a molecular weight of 304.22 g/mol. Its IUPAC name is 3-pyridin-4-yl-1,8-diazaspiro[4.5]decan-2-one;dihydrochloride.
Molecular Properties
| Compound Name | 3-pyridin-4-yl-1,8-diazaspiro[4.5]decan-2-one;dihydrochloride |
| PubChem CID | 118742153 |
| Molecular Formula | C13H19Cl2N3O |
| Molecular Weight | 304.22 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 3-pyridin-4-yl-1,8-diazaspiro[4.5]decan-2-one;dihydrochloride |
| SMILES | Cl.Cl.O=C1NC2(CCNCC2)CC1c1ccncc1 |
| InChI | InChI=1S/C13H17N3O.2ClH/c17-12-11(10-1-5-14-6-2-10)9-13(16-12)3-7-15-8-4-13;;/h1-2,5-6,11,15H,3-4,7-9H2,(H,16,17);2*1H |
| InChIKey | UHYLZVZEOBZTBX-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.22 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-pyridin-4-yl-1,8-diazaspiro[4.5]decan-2-one;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-pyridin-4-yl-1,8-diazaspiro[4.5]decan-2-one;dihydrochloride?
The IUPAC name of 3-pyridin-4-yl-1,8-diazaspiro[4.5]decan-2-one;dihydrochloride (CID 118742153) is 3-pyridin-4-yl-1,8-diazaspiro[4.5]decan-2-one;dihydrochloride.
What is the SMILES notation for 3-pyridin-4-yl-1,8-diazaspiro[4.5]decan-2-one;dihydrochloride?
The canonical SMILES for 3-pyridin-4-yl-1,8-diazaspiro[4.5]decan-2-one;dihydrochloride is Cl.Cl.O=C1NC2(CCNCC2)CC1c1ccncc1.
What is the InChIKey of 3-pyridin-4-yl-1,8-diazaspiro[4.5]decan-2-one;dihydrochloride?
The InChIKey is UHYLZVZEOBZTBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N3O.2ClH/c17-12-11(10-1-5-14-6-2-10)9-13(16-12)3-7-15-8-4-13;;/h1-2,5-6,11,15H,3-4,7-9H2,(H,16,17);2*1H.
What are the key properties of 3-pyridin-4-yl-1,8-diazaspiro[4.5]decan-2-one;dihydrochloride?
3-pyridin-4-yl-1,8-diazaspiro[4.5]decan-2-one;dihydrochloride has a molecular weight of 304.22 g/mol, XLogP of 1.65, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pyridin-4-yl-1,8-diazaspiro[4.5]decan-2-one;dihydrochloride is sourced from PubChem (CID 118742153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).