C16H21F3N4O3S — CID 118743395
4-[(7,8-dimethyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-3-yl)methoxymethyl]-2-methyl-1,3-thiazole;2,2,2-trifluoroacetic acid (PubChem CID 118743395) has the molecular formula C16H21F3N4O3S and a molecular weight of 406.43 g/mol. Its IUPAC name is 4-[(7,8-dimethyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-3-yl)methoxymethyl]-2-methyl-1,3-thiazole;2,2,2-trifluoroacetic acid.
| Compound Name | 4-[(7,8-dimethyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-3-yl)methoxymethyl]-2-methyl-1,3-thiazole;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 118743395 |
| Molecular Formula | C16H21F3N4O3S |
| Molecular Weight | 406.43 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | 4-[(7,8-dimethyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-3-yl)methoxymethyl]-2-methyl-1,3-thiazole;2,2,2-trifluoroacetic acid |
| SMILES | Cc1nc(COCc2cnc3n2CCN(C)C3C)cs1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H20N4OS.C2HF3O2/c1-10-14-15-6-13(18(14)5-4-17(10)3)8-19-7-12-9-20-11(2)16-12;3-2(4,5)1(6)7/h6,9-10H,4-5,7-8H2,1-3H3;(H,6,7) |
| InChIKey | UJPAMXOHQWRZRO-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.43 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |