C20H27F3N4O3S — CID 118744104
4-[[7-(cyclobutylmethyl)-8-methyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-3-yl]methoxymethyl]-2-methyl-1,3-thiazole;2,2,2-trifluoroacetic acid (PubChem CID 118744104) has the molecular formula C20H27F3N4O3S and a molecular weight of 460.52 g/mol. Its IUPAC name is 4-[[7-(cyclobutylmethyl)-8-methyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-3-yl]methoxymethyl]-2-methyl-1,3-thiazole;2,2,2-trifluoroacetic acid.
| Compound Name | 4-[[7-(cyclobutylmethyl)-8-methyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-3-yl]methoxymethyl]-2-methyl-1,3-thiazole;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 118744104 |
| Molecular Formula | C20H27F3N4O3S |
| Molecular Weight | 460.52 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | 4-[[7-(cyclobutylmethyl)-8-methyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-3-yl]methoxymethyl]-2-methyl-1,3-thiazole;2,2,2-trifluoroacetic acid |
| SMILES | Cc1nc(COCc2cnc3n2CCN(CC2CCC2)C3C)cs1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H26N4OS.C2HF3O2/c1-13-18-19-8-17(11-23-10-16-12-24-14(2)20-16)22(18)7-6-21(13)9-15-4-3-5-15;3-2(4,5)1(6)7/h8,12-13,15H,3-7,9-11H2,1-2H3;(H,6,7) |
| InChIKey | DEUVTLCIGJZHGP-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.52 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |