C19H25F3N4O3S — CID 155825647
4-[[7-(cyclopropylmethyl)-8-methyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-3-yl]methoxymethyl]-2-methyl-1,3-thiazole;2,2,2-trifluoroacetic acid (PubChem CID 155825647) has the molecular formula C19H25F3N4O3S and a molecular weight of 446.50 g/mol. Its IUPAC name is 4-[[7-(cyclopropylmethyl)-8-methyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-3-yl]methoxymethyl]-2-methyl-1,3-thiazole;2,2,2-trifluoroacetic acid.
| Compound Name | 4-[[7-(cyclopropylmethyl)-8-methyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-3-yl]methoxymethyl]-2-methyl-1,3-thiazole;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155825647 |
| Molecular Formula | C19H25F3N4O3S |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | 4-[[7-(cyclopropylmethyl)-8-methyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-3-yl]methoxymethyl]-2-methyl-1,3-thiazole;2,2,2-trifluoroacetic acid |
| SMILES | Cc1nc(COCc2cnc3n2CCN(CC2CC2)C3C)cs1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H24N4OS.C2HF3O2/c1-12-17-18-7-16(10-22-9-15-11-23-13(2)19-15)21(17)6-5-20(12)8-14-3-4-14;3-2(4,5)1(6)7/h7,11-12,14H,3-6,8-10H2,1-2H3;(H,6,7) |
| InChIKey | VLKCLQUTBVOUHF-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |