C16H19F3N4O3S — CID 118745011
N,N-dimethyl-7-(thiophen-3-ylmethyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-3-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 118745011) has the molecular formula C16H19F3N4O3S and a molecular weight of 404.41 g/mol. Its IUPAC name is N,N-dimethyl-7-(thiophen-3-ylmethyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-3-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N,N-dimethyl-7-(thiophen-3-ylmethyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-3-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 118745011 |
| Molecular Formula | C16H19F3N4O3S |
| Molecular Weight | 404.41 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | N,N-dimethyl-7-(thiophen-3-ylmethyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-3-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CN(C)C(=O)c1cnc2n1CCN(Cc1ccsc1)C2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H18N4OS.C2HF3O2/c1-16(2)14(19)12-7-15-13-9-17(4-5-18(12)13)8-11-3-6-20-10-11;3-2(4,5)1(6)7/h3,6-7,10H,4-5,8-9H2,1-2H3;(H,6,7) |
| InChIKey | HCLIARZTFREGNB-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.41 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |