C19H22F3N3O5S2 — CID 118745063
2-(2-methoxyethyl)-1'-(1,3-thiazol-2-ylmethyl)spiro[1,2-benzothiazole-3,3'-pyrrolidine] 1,1-dioxide;2,2,2-trifluoroacetic acid (PubChem CID 118745063) has the molecular formula C19H22F3N3O5S2 and a molecular weight of 493.53 g/mol. Its IUPAC name is 2-(2-methoxyethyl)-1'-(1,3-thiazol-2-ylmethyl)spiro[1,2-benzothiazole-3,3'-pyrrolidine] 1,1-dioxide;2,2,2-trifluoroacetic acid.
| Compound Name | 2-(2-methoxyethyl)-1'-(1,3-thiazol-2-ylmethyl)spiro[1,2-benzothiazole-3,3'-pyrrolidine] 1,1-dioxide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 118745063 |
| Molecular Formula | C19H22F3N3O5S2 |
| Molecular Weight | 493.53 g/mol |
| Exact Mass | 493.10 |
| IUPAC Name | 2-(2-methoxyethyl)-1'-(1,3-thiazol-2-ylmethyl)spiro[1,2-benzothiazole-3,3'-pyrrolidine] 1,1-dioxide;2,2,2-trifluoroacetic acid |
| SMILES | COCCN1C2(CCN(Cc3nccs3)C2)c2ccccc2S1(=O)=O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H21N3O3S2.C2HF3O2/c1-23-10-9-20-17(14-4-2-3-5-15(14)25(20,21)22)6-8-19(13-17)12-16-18-7-11-24-16;3-2(4,5)1(6)7/h2-5,7,11H,6,8-10,12-13H2,1H3;(H,6,7) |
| InChIKey | XYTGCWJSFVBDSU-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 100.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.53 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |