C24H23F3N2O4S2 — CID 155857115
2-benzyl-1'-(thiophen-3-ylmethyl)spiro[1,2-benzothiazole-3,3'-pyrrolidine] 1,1-dioxide;2,2,2-trifluoroacetic acid (PubChem CID 155857115) has the molecular formula C24H23F3N2O4S2 and a molecular weight of 524.59 g/mol. Its IUPAC name is 2-benzyl-1'-(thiophen-3-ylmethyl)spiro[1,2-benzothiazole-3,3'-pyrrolidine] 1,1-dioxide;2,2,2-trifluoroacetic acid.
| Compound Name | 2-benzyl-1'-(thiophen-3-ylmethyl)spiro[1,2-benzothiazole-3,3'-pyrrolidine] 1,1-dioxide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155857115 |
| Molecular Formula | C24H23F3N2O4S2 |
| Molecular Weight | 524.59 g/mol |
| Exact Mass | 524.11 |
| IUPAC Name | 2-benzyl-1'-(thiophen-3-ylmethyl)spiro[1,2-benzothiazole-3,3'-pyrrolidine] 1,1-dioxide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=S1(=O)c2ccccc2C2(CCN(Cc3ccsc3)C2)N1Cc1ccccc1 |
| InChI | InChI=1S/C22H22N2O2S2.C2HF3O2/c25-28(26)21-9-5-4-8-20(21)22(24(28)15-18-6-2-1-3-7-18)11-12-23(17-22)14-19-10-13-27-16-19;3-2(4,5)1(6)7/h1-10,13,16H,11-12,14-15,17H2;(H,6,7) |
| InChIKey | UHVKPIZXBMYHAI-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.59 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |