C16H19F3N4O4S — CID 118745121
[1-ethyl-4-(methoxymethyl)-5,7-dihydro-4H-pyrazolo[5,4-c]pyridin-6-yl]-(1,3-thiazol-4-yl)methanone;2,2,2-trifluoroacetic acid (PubChem CID 118745121) has the molecular formula C16H19F3N4O4S and a molecular weight of 420.41 g/mol. Its IUPAC name is [1-ethyl-4-(methoxymethyl)-5,7-dihydro-4H-pyrazolo[5,4-c]pyridin-6-yl]-(1,3-thiazol-4-yl)methanone;2,2,2-trifluoroacetic acid.
| Compound Name | [1-ethyl-4-(methoxymethyl)-5,7-dihydro-4H-pyrazolo[5,4-c]pyridin-6-yl]-(1,3-thiazol-4-yl)methanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 118745121 |
| Molecular Formula | C16H19F3N4O4S |
| Molecular Weight | 420.41 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | [1-ethyl-4-(methoxymethyl)-5,7-dihydro-4H-pyrazolo[5,4-c]pyridin-6-yl]-(1,3-thiazol-4-yl)methanone;2,2,2-trifluoroacetic acid |
| SMILES | CCn1ncc2c1CN(C(=O)c1cscn1)CC2COC.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H18N4O2S.C2HF3O2/c1-3-18-13-6-17(14(19)12-8-21-9-15-12)5-10(7-20-2)11(13)4-16-18;3-2(4,5)1(6)7/h4,8-10H,3,5-7H2,1-2H3;(H,6,7) |
| InChIKey | IEMNHYUNLDKYDP-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.41 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |