C13H16F3N5O3S — CID 118745259
1-(3-methyl-6,7-dihydro-4H-triazolo[5,1-c][1,4]oxazin-6-yl)-N-(1,3-thiazol-2-ylmethyl)methanamine;2,2,2-trifluoroacetic acid (PubChem CID 118745259) has the molecular formula C13H16F3N5O3S and a molecular weight of 379.36 g/mol. Its IUPAC name is 1-(3-methyl-6,7-dihydro-4H-triazolo[5,1-c][1,4]oxazin-6-yl)-N-(1,3-thiazol-2-ylmethyl)methanamine;2,2,2-trifluoroacetic acid.
| Compound Name | 1-(3-methyl-6,7-dihydro-4H-triazolo[5,1-c][1,4]oxazin-6-yl)-N-(1,3-thiazol-2-ylmethyl)methanamine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 118745259 |
| Molecular Formula | C13H16F3N5O3S |
| Molecular Weight | 379.36 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | 1-(3-methyl-6,7-dihydro-4H-triazolo[5,1-c][1,4]oxazin-6-yl)-N-(1,3-thiazol-2-ylmethyl)methanamine;2,2,2-trifluoroacetic acid |
| SMILES | Cc1nnn2c1COC(CNCc1nccs1)C2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C11H15N5OS.C2HF3O2/c1-8-10-7-17-9(6-16(10)15-14-8)4-12-5-11-13-2-3-18-11;3-2(4,5)1(6)7/h2-3,9,12H,4-7H2,1H3;(H,6,7) |
| InChIKey | URDIAIGAPNWRLT-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.36 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |