C16H18F6N4O5S — CID 155845433
1-(2-methyl-5,7-dihydro-4H-pyrano[3,4-c]pyrazol-7-yl)-N-(1,3-thiazol-2-ylmethyl)methanamine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155845433) has the molecular formula C16H18F6N4O5S and a molecular weight of 492.40 g/mol. Its IUPAC name is 1-(2-methyl-5,7-dihydro-4H-pyrano[3,4-c]pyrazol-7-yl)-N-(1,3-thiazol-2-ylmethyl)methanamine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 1-(2-methyl-5,7-dihydro-4H-pyrano[3,4-c]pyrazol-7-yl)-N-(1,3-thiazol-2-ylmethyl)methanamine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155845433 |
| Molecular Formula | C16H18F6N4O5S |
| Molecular Weight | 492.40 g/mol |
| Exact Mass | 492.09 |
| IUPAC Name | 1-(2-methyl-5,7-dihydro-4H-pyrano[3,4-c]pyrazol-7-yl)-N-(1,3-thiazol-2-ylmethyl)methanamine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | Cn1cc2c(n1)C(CNCc1nccs1)OCC2.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C12H16N4OS.2C2HF3O2/c1-16-8-9-2-4-17-10(12(9)15-16)6-13-7-11-14-3-5-18-11;2*3-2(4,5)1(6)7/h3,5,8,10,13H,2,4,6-7H2,1H3;2*(H,6,7) |
| InChIKey | JNQNPYTWIPFIBP-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 126.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.40 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |