C21H27F3N4O5 — CID 171694221
2-[7-[[(4-methoxyphenyl)methylamino]methyl]-5,7-dihydro-4H-pyrano[3,4-c]pyrazol-2-yl]-N,N-dimethylacetamide;2,2,2-trifluoroacetic acid (PubChem CID 171694221) has the molecular formula C21H27F3N4O5 and a molecular weight of 472.46 g/mol. Its IUPAC name is 2-[7-[[(4-methoxyphenyl)methylamino]methyl]-5,7-dihydro-4H-pyrano[3,4-c]pyrazol-2-yl]-N,N-dimethylacetamide;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[7-[[(4-methoxyphenyl)methylamino]methyl]-5,7-dihydro-4H-pyrano[3,4-c]pyrazol-2-yl]-N,N-dimethylacetamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 171694221 |
| Molecular Formula | C21H27F3N4O5 |
| Molecular Weight | 472.46 g/mol |
| Exact Mass | 472.19 |
| IUPAC Name | 2-[7-[[(4-methoxyphenyl)methylamino]methyl]-5,7-dihydro-4H-pyrano[3,4-c]pyrazol-2-yl]-N,N-dimethylacetamide;2,2,2-trifluoroacetic acid |
| SMILES | COc1ccc(CNCC2OCCc3cn(CC(=O)N(C)C)nc32)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H26N4O3.C2HF3O2/c1-22(2)18(24)13-23-12-15-8-9-26-17(19(15)21-23)11-20-10-14-4-6-16(25-3)7-5-14;3-2(4,5)1(6)7/h4-7,12,17,20H,8-11,13H2,1-3H3;(H,6,7) |
| InChIKey | HCWDJFKQPTWBFO-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.46 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |