C21H26F6N4O5S — CID 118745709
2-[[7-(cyclopropylmethoxymethyl)-1-ethyl-5,7-dihydro-4H-pyrazolo[5,4-c]pyridin-6-yl]methyl]-1,3-thiazole;bis(2,2,2-trifluoroacetic acid) (PubChem CID 118745709) has the molecular formula C21H26F6N4O5S and a molecular weight of 560.52 g/mol. Its IUPAC name is 2-[[7-(cyclopropylmethoxymethyl)-1-ethyl-5,7-dihydro-4H-pyrazolo[5,4-c]pyridin-6-yl]methyl]-1,3-thiazole;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 2-[[7-(cyclopropylmethoxymethyl)-1-ethyl-5,7-dihydro-4H-pyrazolo[5,4-c]pyridin-6-yl]methyl]-1,3-thiazole;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 118745709 |
| Molecular Formula | C21H26F6N4O5S |
| Molecular Weight | 560.52 g/mol |
| Exact Mass | 560.15 |
| IUPAC Name | 2-[[7-(cyclopropylmethoxymethyl)-1-ethyl-5,7-dihydro-4H-pyrazolo[5,4-c]pyridin-6-yl]methyl]-1,3-thiazole;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CCn1ncc2c1C(COCC1CC1)N(Cc1nccs1)CC2.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H24N4OS.2C2HF3O2/c1-2-21-17-14(9-19-21)5-7-20(10-16-18-6-8-23-16)15(17)12-22-11-13-3-4-13;2*3-2(4,5)1(6)7/h6,8-9,13,15H,2-5,7,10-12H2,1H3;2*(H,6,7) |
| InChIKey | VYPUESDXTOLONF-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 117.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.52 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |