C21H25F6N5O5S — CID 118745940
(7-ethyl-3-methylspiro[5,6-dihydroimidazo[1,2-a]pyrazine-8,4'-piperidine]-1'-yl)-(1,3-thiazol-4-yl)methanone;bis(2,2,2-trifluoroacetic acid) (PubChem CID 118745940) has the molecular formula C21H25F6N5O5S and a molecular weight of 573.52 g/mol. Its IUPAC name is (7-ethyl-3-methylspiro[5,6-dihydroimidazo[1,2-a]pyrazine-8,4'-piperidine]-1'-yl)-(1,3-thiazol-4-yl)methanone;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (7-ethyl-3-methylspiro[5,6-dihydroimidazo[1,2-a]pyrazine-8,4'-piperidine]-1'-yl)-(1,3-thiazol-4-yl)methanone;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 118745940 |
| Molecular Formula | C21H25F6N5O5S |
| Molecular Weight | 573.52 g/mol |
| Exact Mass | 573.15 |
| IUPAC Name | (7-ethyl-3-methylspiro[5,6-dihydroimidazo[1,2-a]pyrazine-8,4'-piperidine]-1'-yl)-(1,3-thiazol-4-yl)methanone;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CCN1CCn2c(C)cnc2C12CCN(C(=O)c1cscn1)CC2.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H23N5OS.2C2HF3O2/c1-3-21-8-9-22-13(2)10-18-16(22)17(21)4-6-20(7-5-17)15(23)14-11-24-12-19-14;2*3-2(4,5)1(6)7/h10-12H,3-9H2,1-2H3;2*(H,6,7) |
| InChIKey | PHDSBGMVCOAYDT-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 128.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.52 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |