C15H18F3N5O3S — CID 155839589
N,N-dimethyl-7-(1,3-thiazol-2-ylmethyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-3-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 155839589) has the molecular formula C15H18F3N5O3S and a molecular weight of 405.40 g/mol. Its IUPAC name is N,N-dimethyl-7-(1,3-thiazol-2-ylmethyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-3-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N,N-dimethyl-7-(1,3-thiazol-2-ylmethyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-3-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155839589 |
| Molecular Formula | C15H18F3N5O3S |
| Molecular Weight | 405.40 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | N,N-dimethyl-7-(1,3-thiazol-2-ylmethyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-3-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CN(C)C(=O)c1cnc2n1CCN(Cc1nccs1)C2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C13H17N5OS.C2HF3O2/c1-16(2)13(19)10-7-15-11-8-17(4-5-18(10)11)9-12-14-3-6-20-12;3-2(4,5)1(6)7/h3,6-7H,4-5,8-9H2,1-2H3;(H,6,7) |
| InChIKey | FLUUNPXJXLLFDD-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.40 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |