C21H24F6N4O6S — CID 118746803
4-ethylsulfonyl-8-methyl-1-(pyridin-3-ylmethyl)-3,5-dihydro-2H-pyrido[2,3-e][1,4]diazepine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 118746803) has the molecular formula C21H24F6N4O6S and a molecular weight of 574.50 g/mol. Its IUPAC name is 4-ethylsulfonyl-8-methyl-1-(pyridin-3-ylmethyl)-3,5-dihydro-2H-pyrido[2,3-e][1,4]diazepine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 4-ethylsulfonyl-8-methyl-1-(pyridin-3-ylmethyl)-3,5-dihydro-2H-pyrido[2,3-e][1,4]diazepine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 118746803 |
| Molecular Formula | C21H24F6N4O6S |
| Molecular Weight | 574.50 g/mol |
| Exact Mass | 574.13 |
| IUPAC Name | 4-ethylsulfonyl-8-methyl-1-(pyridin-3-ylmethyl)-3,5-dihydro-2H-pyrido[2,3-e][1,4]diazepine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CCS(=O)(=O)N1CCN(Cc2cccnc2)c2nc(C)ccc2C1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H22N4O2S.2C2HF3O2/c1-3-24(22,23)21-10-9-20(12-15-5-4-8-18-11-15)17-16(13-21)7-6-14(2)19-17;2*3-2(4,5)1(6)7/h4-8,11H,3,9-10,12-13H2,1-2H3;2*(H,6,7) |
| InChIKey | BKMNXAJOYZTPPW-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 141.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.50 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |