C13H15NO5 — CID 11874869
methyl (1S,2R,9R,10S,11R)-8-oxo-3,14-dioxa-7-azatetracyclo[9.2.1.01,9.02,7]tetradec-12-ene-10-carboxylate (PubChem CID 11874869) has the molecular formula C13H15NO5 and a molecular weight of 265.26 g/mol. Its IUPAC name is methyl (1S,2R,9R,10S,11R)-8-oxo-3,14-dioxa-7-azatetracyclo[9.2.1.01,9.02,7]tetradec-12-ene-10-carboxylate.
| Compound Name | methyl (1S,2R,9R,10S,11R)-8-oxo-3,14-dioxa-7-azatetracyclo[9.2.1.01,9.02,7]tetradec-12-ene-10-carboxylate |
|---|---|
| PubChem CID | 11874869 |
| Molecular Formula | C13H15NO5 |
| Molecular Weight | 265.26 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | methyl (1S,2R,9R,10S,11R)-8-oxo-3,14-dioxa-7-azatetracyclo[9.2.1.01,9.02,7]tetradec-12-ene-10-carboxylate |
| SMILES | COC(=O)[C@H]1[C@H]2C(=O)N3CCCO[C@@H]3[C@]23C=C[C@H]1O3 |
| InChI | InChI=1S/C13H15NO5/c1-17-11(16)8-7-3-4-13(19-7)9(8)10(15)14-5-2-6-18-12(13)14/h3-4,7-9,12H,2,5-6H2,1H3/t7-,8-,9+,12-,13+/m1/s1 |
| InChIKey | OIOMJQJOJNSNNC-OAEYFNCWSA-N |
| XLogP | -0.31 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.26 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|