C20H21NO6 — CID 11874567
methyl (1S,2S,3S,5S,6S,9S,10R,11R)-6-(furan-2-yl)-3,5-dimethyl-4,8-dioxo-14-oxa-7-azatetracyclo[9.2.1.01,9.02,7]tetradec-12-ene-10-carboxylate (PubChem CID 11874567) has the molecular formula C20H21NO6 and a molecular weight of 371.39 g/mol. Its IUPAC name is methyl (1S,2S,3S,5S,6S,9S,10R,11R)-6-(furan-2-yl)-3,5-dimethyl-4,8-dioxo-14-oxa-7-azatetracyclo[9.2.1.01,9.02,7]tetradec-12-ene-10-carboxylate.
| Compound Name | methyl (1S,2S,3S,5S,6S,9S,10R,11R)-6-(furan-2-yl)-3,5-dimethyl-4,8-dioxo-14-oxa-7-azatetracyclo[9.2.1.01,9.02,7]tetradec-12-ene-10-carboxylate |
|---|---|
| PubChem CID | 11874567 |
| Molecular Formula | C20H21NO6 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | methyl (1S,2S,3S,5S,6S,9S,10R,11R)-6-(furan-2-yl)-3,5-dimethyl-4,8-dioxo-14-oxa-7-azatetracyclo[9.2.1.01,9.02,7]tetradec-12-ene-10-carboxylate |
| SMILES | COC(=O)[C@H]1[C@H]2C=C[C@@]3(O2)[C@@H]2[C@H](C)C(=O)[C@@H](C)[C@@H](c4ccco4)N2C(=O)[C@@H]13 |
| InChI | InChI=1S/C20H21NO6/c1-9-15(12-5-4-8-26-12)21-17(10(2)16(9)22)20-7-6-11(27-20)13(19(24)25-3)14(20)18(21)23/h4-11,13-15,17H,1-3H3/t9-,10+,11+,13-,14+,15-,17-,20-/m0/s1 |
| InChIKey | VEGDJTLZYKPHPF-VHXNRBNISA-N |
| XLogP | 1.50 |
| TPSA | 86.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|