C26H26N2O6 — CID 99980834
(1R,2R,3R,6R,9R,10R,11R)-6-(furan-2-yl)-N-[(4-methoxyphenyl)methyl]-3-methyl-4,8-dioxo-14-oxa-7-azatetracyclo[9.2.1.01,9.02,7]tetradec-12-ene-10-carboxamide (PubChem CID 99980834) has the molecular formula C26H26N2O6 and a molecular weight of 462.50 g/mol. Its IUPAC name is (1R,2R,3R,6R,9R,10R,11R)-6-(furan-2-yl)-N-[(4-methoxyphenyl)methyl]-3-methyl-4,8-dioxo-14-oxa-7-azatetracyclo[9.2.1.01,9.02,7]tetradec-12-ene-10-carboxamide.
| Compound Name | (1R,2R,3R,6R,9R,10R,11R)-6-(furan-2-yl)-N-[(4-methoxyphenyl)methyl]-3-methyl-4,8-dioxo-14-oxa-7-azatetracyclo[9.2.1.01,9.02,7]tetradec-12-ene-10-carboxamide |
|---|---|
| PubChem CID | 99980834 |
| Molecular Formula | C26H26N2O6 |
| Molecular Weight | 462.50 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | (1R,2R,3R,6R,9R,10R,11R)-6-(furan-2-yl)-N-[(4-methoxyphenyl)methyl]-3-methyl-4,8-dioxo-14-oxa-7-azatetracyclo[9.2.1.01,9.02,7]tetradec-12-ene-10-carboxamide |
| SMILES | COc1ccc(CNC(=O)[C@@H]2[C@H]3C(=O)N4[C@@H](c5ccco5)CC(=O)[C@H](C)[C@@H]4[C@@]34C=C[C@H]2O4)cc1 |
| InChI | InChI=1S/C26H26N2O6/c1-14-18(29)12-17(19-4-3-11-33-19)28-23(14)26-10-9-20(34-26)21(22(26)25(28)31)24(30)27-13-15-5-7-16(32-2)8-6-15/h3-11,14,17,20-23H,12-13H2,1-2H3,(H,27,30)/t14-,17+,20+,21-,22-,23+,26+/m0/s1 |
| InChIKey | DHDLGDJICXZNAK-MGFJRNAPSA-N |
| XLogP | 2.41 |
| TPSA | 98.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.50 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|