C25H29N3O7 — CID 124836287
ethyl 4-[(1R,2R,3S,6S,9R,10S,11R)-6-(furan-2-yl)-3-methyl-4,8-dioxo-14-oxa-7-azatetracyclo[9.2.1.01,9.02,7]tetradec-12-ene-10-carbonyl]piperazine-1-carboxylate (PubChem CID 124836287) has the molecular formula C25H29N3O7 and a molecular weight of 483.52 g/mol. Its IUPAC name is ethyl 4-[(1R,2R,3S,6S,9R,10S,11R)-6-(furan-2-yl)-3-methyl-4,8-dioxo-14-oxa-7-azatetracyclo[9.2.1.01,9.02,7]tetradec-12-ene-10-carbonyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[(1R,2R,3S,6S,9R,10S,11R)-6-(furan-2-yl)-3-methyl-4,8-dioxo-14-oxa-7-azatetracyclo[9.2.1.01,9.02,7]tetradec-12-ene-10-carbonyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 124836287 |
| Molecular Formula | C25H29N3O7 |
| Molecular Weight | 483.52 g/mol |
| Exact Mass | 483.20 |
| IUPAC Name | ethyl 4-[(1R,2R,3S,6S,9R,10S,11R)-6-(furan-2-yl)-3-methyl-4,8-dioxo-14-oxa-7-azatetracyclo[9.2.1.01,9.02,7]tetradec-12-ene-10-carbonyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)[C@H]2[C@H]3C(=O)N4[C@H](c5ccco5)CC(=O)[C@@H](C)[C@@H]4[C@@]34C=C[C@H]2O4)CC1 |
| InChI | InChI=1S/C25H29N3O7/c1-3-33-24(32)27-10-8-26(9-11-27)22(30)19-18-6-7-25(35-18)20(19)23(31)28-15(17-5-4-12-34-17)13-16(29)14(2)21(25)28/h4-7,12,14-15,18-21H,3,8-11,13H2,1-2H3/t14-,15+,18-,19-,20+,21-,25-/m1/s1 |
| InChIKey | XOYYBFLPFJVFEL-RCGXYSGDSA-N |
| XLogP | 1.38 |
| TPSA | 109.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.52 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|