C28H30N2O5 — CID 51446374
(1S,2S,3R,6S,9S,10R,11R)-6-(furan-2-yl)-3-methyl-4,8-dioxo-N-[(2S)-4-phenylbutan-2-yl]-14-oxa-7-azatetracyclo[9.2.1.01,9.02,7]tetradec-12-ene-10-carboxamide (PubChem CID 51446374) has the molecular formula C28H30N2O5 and a molecular weight of 474.56 g/mol. Its IUPAC name is (1S,2S,3R,6S,9S,10R,11R)-6-(furan-2-yl)-3-methyl-4,8-dioxo-N-[(2S)-4-phenylbutan-2-yl]-14-oxa-7-azatetracyclo[9.2.1.01,9.02,7]tetradec-12-ene-10-carboxamide.
| Compound Name | (1S,2S,3R,6S,9S,10R,11R)-6-(furan-2-yl)-3-methyl-4,8-dioxo-N-[(2S)-4-phenylbutan-2-yl]-14-oxa-7-azatetracyclo[9.2.1.01,9.02,7]tetradec-12-ene-10-carboxamide |
|---|---|
| PubChem CID | 51446374 |
| Molecular Formula | C28H30N2O5 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.22 |
| IUPAC Name | (1S,2S,3R,6S,9S,10R,11R)-6-(furan-2-yl)-3-methyl-4,8-dioxo-N-[(2S)-4-phenylbutan-2-yl]-14-oxa-7-azatetracyclo[9.2.1.01,9.02,7]tetradec-12-ene-10-carboxamide |
| SMILES | C[C@@H](CCc1ccccc1)NC(=O)[C@H]1[C@H]2C=C[C@@]3(O2)[C@@H]2[C@@H](C)C(=O)C[C@@H](c4ccco4)N2C(=O)[C@@H]13 |
| InChI | InChI=1S/C28H30N2O5/c1-16(10-11-18-7-4-3-5-8-18)29-26(32)23-22-12-13-28(35-22)24(23)27(33)30-19(21-9-6-14-34-21)15-20(31)17(2)25(28)30/h3-9,12-14,16-17,19,22-25H,10-11,15H2,1-2H3,(H,29,32)/t16-,17-,19-,22+,23-,24+,25-,28-/m0/s1 |
| InChIKey | SEYVRDQQSZQTJM-FHVOTDTLSA-N |
| XLogP | 3.22 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|