C19H18NO6- — CID 11874525
(1S,2S,3S,5R,6S,9S,10R,11R)-6-(furan-2-yl)-3,5-dimethyl-4,8-dioxo-14-oxa-7-azatetracyclo[9.2.1.01,9.02,7]tetradec-12-ene-10-carboxylate (PubChem CID 11874525) has the molecular formula C19H18NO6- and a molecular weight of 356.35 g/mol. Its IUPAC name is (1S,2S,3S,5R,6S,9S,10R,11R)-6-(furan-2-yl)-3,5-dimethyl-4,8-dioxo-14-oxa-7-azatetracyclo[9.2.1.01,9.02,7]tetradec-12-ene-10-carboxylate.
| Compound Name | (1S,2S,3S,5R,6S,9S,10R,11R)-6-(furan-2-yl)-3,5-dimethyl-4,8-dioxo-14-oxa-7-azatetracyclo[9.2.1.01,9.02,7]tetradec-12-ene-10-carboxylate |
|---|---|
| PubChem CID | 11874525 |
| Molecular Formula | C19H18NO6- |
| Molecular Weight | 356.35 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | (1S,2S,3S,5R,6S,9S,10R,11R)-6-(furan-2-yl)-3,5-dimethyl-4,8-dioxo-14-oxa-7-azatetracyclo[9.2.1.01,9.02,7]tetradec-12-ene-10-carboxylate |
| SMILES | C[C@@H]1C(=O)[C@H](C)[C@@H](c2ccco2)N2C(=O)[C@H]3[C@@H](C(=O)[O-])[C@H]4C=C[C@@]3(O4)[C@H]12 |
| InChI | InChI=1S/C19H19NO6/c1-8-14(11-4-3-7-25-11)20-16(9(2)15(8)21)19-6-5-10(26-19)12(18(23)24)13(19)17(20)22/h3-10,12-14,16H,1-2H3,(H,23,24)/p-1/t8-,9-,10-,12+,13-,14+,16+,19+/m1/s1 |
| InChIKey | LXIQMFKOABADKQ-WWKFEUJKSA-M |
| XLogP | 0.08 |
| TPSA | 99.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.35 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|