C23H35N3O2 — CID 118755342
[4-[4-(cyclohexylamino)piperidin-1-yl]phenyl]-(3-hydroxypiperidin-1-yl)methanone (PubChem CID 118755342) has the molecular formula C23H35N3O2 and a molecular weight of 385.55 g/mol. Its IUPAC name is [4-[4-(cyclohexylamino)piperidin-1-yl]phenyl]-(3-hydroxypiperidin-1-yl)methanone.
| Compound Name | [4-[4-(cyclohexylamino)piperidin-1-yl]phenyl]-(3-hydroxypiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 118755342 |
| Molecular Formula | C23H35N3O2 |
| Molecular Weight | 385.55 g/mol |
| Exact Mass | 385.27 |
| IUPAC Name | [4-[4-(cyclohexylamino)piperidin-1-yl]phenyl]-(3-hydroxypiperidin-1-yl)methanone |
| SMILES | O=C(c1ccc(N2CCC(NC3CCCCC3)CC2)cc1)N1CCCC(O)C1 |
| InChI | InChI=1S/C23H35N3O2/c27-22-7-4-14-26(17-22)23(28)18-8-10-21(11-9-18)25-15-12-20(13-16-25)24-19-5-2-1-3-6-19/h8-11,19-20,22,24,27H,1-7,12-17H2 |
| InChIKey | UYJJAFBIDFLALE-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.55 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |