C23H31N3O3 — CID 118756027
[7-[[(2R,6S)-2,6-dimethylmorpholin-4-yl]methyl]-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]-(3,5-dimethyl-1H-pyrrol-2-yl)methanone (PubChem CID 118756027) has the molecular formula C23H31N3O3 and a molecular weight of 397.52 g/mol. Its IUPAC name is [7-[[(2R,6S)-2,6-dimethylmorpholin-4-yl]methyl]-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]-(3,5-dimethyl-1H-pyrrol-2-yl)methanone.
| Compound Name | [7-[[(2R,6S)-2,6-dimethylmorpholin-4-yl]methyl]-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]-(3,5-dimethyl-1H-pyrrol-2-yl)methanone |
|---|---|
| PubChem CID | 118756027 |
| Molecular Formula | C23H31N3O3 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.24 |
| IUPAC Name | [7-[[(2R,6S)-2,6-dimethylmorpholin-4-yl]methyl]-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]-(3,5-dimethyl-1H-pyrrol-2-yl)methanone |
| SMILES | Cc1cc(C)c(C(=O)N2CCOc3ccc(CN4C[C@@H](C)O[C@@H](C)C4)cc3C2)[nH]1 |
| InChI | InChI=1S/C23H31N3O3/c1-15-9-16(2)24-22(15)23(27)26-7-8-28-21-6-5-19(10-20(21)14-26)13-25-11-17(3)29-18(4)12-25/h5-6,9-10,17-18,24H,7-8,11-14H2,1-4H3/t17-,18+ |
| InChIKey | LSVCCDTYBHJXBN-HDICACEKSA-N |
| XLogP | 3.28 |
| TPSA | 57.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |