C28H34N4O2 — CID 118756279
4-methyl-N-[2-[4-[[4-(pyridin-3-ylmethyl)piperazin-1-yl]methyl]phenoxy]propyl]benzamide (PubChem CID 118756279) has the molecular formula C28H34N4O2 and a molecular weight of 458.61 g/mol. Its IUPAC name is 4-methyl-N-[2-[4-[[4-(pyridin-3-ylmethyl)piperazin-1-yl]methyl]phenoxy]propyl]benzamide.
| Compound Name | 4-methyl-N-[2-[4-[[4-(pyridin-3-ylmethyl)piperazin-1-yl]methyl]phenoxy]propyl]benzamide |
|---|---|
| PubChem CID | 118756279 |
| Molecular Formula | C28H34N4O2 |
| Molecular Weight | 458.61 g/mol |
| Exact Mass | 458.27 |
| IUPAC Name | 4-methyl-N-[2-[4-[[4-(pyridin-3-ylmethyl)piperazin-1-yl]methyl]phenoxy]propyl]benzamide |
| SMILES | Cc1ccc(C(=O)NCC(C)Oc2ccc(CN3CCN(Cc4cccnc4)CC3)cc2)cc1 |
| InChI | InChI=1S/C28H34N4O2/c1-22-5-9-26(10-6-22)28(33)30-18-23(2)34-27-11-7-24(8-12-27)20-31-14-16-32(17-15-31)21-25-4-3-13-29-19-25/h3-13,19,23H,14-18,20-21H2,1-2H3,(H,30,33) |
| InChIKey | BFMULMCNNYKEMI-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.61 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |