C25H24N2O4S — CID 118757703
2-[[7-(1,3-benzothiazol-2-yl)-9-methoxy-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]methyl]-5-methoxyphenol (PubChem CID 118757703) has the molecular formula C25H24N2O4S and a molecular weight of 448.54 g/mol. Its IUPAC name is 2-[[7-(1,3-benzothiazol-2-yl)-9-methoxy-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]methyl]-5-methoxyphenol.
| Compound Name | 2-[[7-(1,3-benzothiazol-2-yl)-9-methoxy-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]methyl]-5-methoxyphenol |
|---|---|
| PubChem CID | 118757703 |
| Molecular Formula | C25H24N2O4S |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | 2-[[7-(1,3-benzothiazol-2-yl)-9-methoxy-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]methyl]-5-methoxyphenol |
| SMILES | COc1ccc(CN2CCOc3c(cc(-c4nc5ccccc5s4)cc3OC)C2)c(O)c1 |
| InChI | InChI=1S/C25H24N2O4S/c1-29-19-8-7-16(21(28)13-19)14-27-9-10-31-24-18(15-27)11-17(12-22(24)30-2)25-26-20-5-3-4-6-23(20)32-25/h3-8,11-13,28H,9-10,14-15H2,1-2H3 |
| InChIKey | IGBBXAYTOQVEPW-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 64.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|