C25H27NO4 — CID 26346334
4-methoxy-2-[[9-methoxy-7-(4-methylphenyl)-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]methyl]phenol (PubChem CID 26346334) has the molecular formula C25H27NO4 and a molecular weight of 405.49 g/mol. Its IUPAC name is 4-methoxy-2-[[9-methoxy-7-(4-methylphenyl)-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]methyl]phenol.
| Compound Name | 4-methoxy-2-[[9-methoxy-7-(4-methylphenyl)-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]methyl]phenol |
|---|---|
| PubChem CID | 26346334 |
| Molecular Formula | C25H27NO4 |
| Molecular Weight | 405.49 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | 4-methoxy-2-[[9-methoxy-7-(4-methylphenyl)-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]methyl]phenol |
| SMILES | COc1ccc(O)c(CN2CCOc3c(cc(-c4ccc(C)cc4)cc3OC)C2)c1 |
| InChI | InChI=1S/C25H27NO4/c1-17-4-6-18(7-5-17)19-12-21-16-26(10-11-30-25(21)24(14-19)29-3)15-20-13-22(28-2)8-9-23(20)27/h4-9,12-14,27H,10-11,15-16H2,1-3H3 |
| InChIKey | KYAQBTRMNJDGLL-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.49 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|