C16H21ClN2O — CID 118759259
(4aR,8aS)-1-[2-(3-chlorophenyl)ethyl]-3,4,4a,5,6,7,8,8a-octahydro-1,6-naphthyridin-2-one (PubChem CID 118759259) has the molecular formula C16H21ClN2O and a molecular weight of 292.81 g/mol. Its IUPAC name is (4aR,8aS)-1-[2-(3-chlorophenyl)ethyl]-3,4,4a,5,6,7,8,8a-octahydro-1,6-naphthyridin-2-one.
| Compound Name | (4aR,8aS)-1-[2-(3-chlorophenyl)ethyl]-3,4,4a,5,6,7,8,8a-octahydro-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 118759259 |
| Molecular Formula | C16H21ClN2O |
| Molecular Weight | 292.81 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | (4aR,8aS)-1-[2-(3-chlorophenyl)ethyl]-3,4,4a,5,6,7,8,8a-octahydro-1,6-naphthyridin-2-one |
| SMILES | O=C1CC[C@@H]2CNCC[C@@H]2N1CCc1cccc(Cl)c1 |
| InChI | InChI=1S/C16H21ClN2O/c17-14-3-1-2-12(10-14)7-9-19-15-6-8-18-11-13(15)4-5-16(19)20/h1-3,10,13,15,18H,4-9,11H2/t13-,15+/m1/s1 |
| InChIKey | RTBAJJIWRDJTNE-HIFRSBDPSA-N |
| XLogP | 2.48 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.81 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |