C16H24N4O3 — CID 118760059
2-[6-(4-cyclohexylpiperazin-1-yl)pyridazin-3-yl]oxyacetic acid (PubChem CID 118760059) has the molecular formula C16H24N4O3 and a molecular weight of 320.39 g/mol. Its IUPAC name is 2-[6-(4-cyclohexylpiperazin-1-yl)pyridazin-3-yl]oxyacetic acid.
| Compound Name | 2-[6-(4-cyclohexylpiperazin-1-yl)pyridazin-3-yl]oxyacetic acid |
|---|---|
| PubChem CID | 118760059 |
| Molecular Formula | C16H24N4O3 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | 2-[6-(4-cyclohexylpiperazin-1-yl)pyridazin-3-yl]oxyacetic acid |
| SMILES | O=C(O)COc1ccc(N2CCN(C3CCCCC3)CC2)nn1 |
| InChI | InChI=1S/C16H24N4O3/c21-16(22)12-23-15-7-6-14(17-18-15)20-10-8-19(9-11-20)13-4-2-1-3-5-13/h6-7,13H,1-5,8-12H2,(H,21,22) |
| InChIKey | WCHNTRKENOWUDA-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |