C16H19F3N6O — CID 118760123
[(2S,4S)-4-azidopyrrolidin-2-yl]-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]methanone (PubChem CID 118760123) has the molecular formula C16H19F3N6O and a molecular weight of 368.36 g/mol. Its IUPAC name is [(2S,4S)-4-azidopyrrolidin-2-yl]-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]methanone.
| Compound Name | [(2S,4S)-4-azidopyrrolidin-2-yl]-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 118760123 |
| Molecular Formula | C16H19F3N6O |
| Molecular Weight | 368.36 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | [(2S,4S)-4-azidopyrrolidin-2-yl]-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]methanone |
| SMILES | [N-]=[N+]=N[C@@H]1CN[C@H](C(=O)N2CCN(c3cccc(C(F)(F)F)c3)CC2)C1 |
| InChI | InChI=1S/C16H19F3N6O/c17-16(18,19)11-2-1-3-13(8-11)24-4-6-25(7-5-24)15(26)14-9-12(10-21-14)22-23-20/h1-3,8,12,14,21H,4-7,9-10H2/t12-,14-/m0/s1 |
| InChIKey | IRUIWPDHEWZMDF-JSGCOSHPSA-N |
| XLogP | 2.39 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.36 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|